C14H20N6O — CID 12671250
4-[2-(7-methyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)ethyl]morpholine (PubChem CID 12671250) has the molecular formula C14H20N6O and a molecular weight of 288.35 g/mol. Its IUPAC name is 4-[2-(7-methyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)ethyl]morpholine.
| Compound Name | 4-[2-(7-methyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)ethyl]morpholine |
|---|---|
| PubChem CID | 12671250 |
| Molecular Formula | C14H20N6O |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 4-[2-(7-methyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)ethyl]morpholine |
| SMILES | Cc1nc2ncnn2c2c1CCN2CCN1CCOCC1 |
| InChI | InChI=1S/C14H20N6O/c1-11-12-2-3-19(5-4-18-6-8-21-9-7-18)13(12)20-14(17-11)15-10-16-20/h10H,2-9H2,1H3 |
| InChIKey | SPDRRKXTOZTJOS-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 58.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |