C15H23N7 — CID 12671251
7-methyl-3-[2-(4-methylpiperazin-1-yl)ethyl]-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene (PubChem CID 12671251) has the molecular formula C15H23N7 and a molecular weight of 301.40 g/mol. Its IUPAC name is 7-methyl-3-[2-(4-methylpiperazin-1-yl)ethyl]-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene.
| Compound Name | 7-methyl-3-[2-(4-methylpiperazin-1-yl)ethyl]-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
|---|---|
| PubChem CID | 12671251 |
| Molecular Formula | C15H23N7 |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | 7-methyl-3-[2-(4-methylpiperazin-1-yl)ethyl]-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
| SMILES | Cc1nc2ncnn2c2c1CCN2CCN1CCN(C)CC1 |
| InChI | InChI=1S/C15H23N7/c1-12-13-3-4-21(10-9-20-7-5-19(2)6-8-20)14(13)22-15(18-12)16-11-17-22/h11H,3-10H2,1-2H3 |
| InChIKey | KCEOIJQZFNKQHB-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 52.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |