C16H16N6O2 — CID 12671261
2-(7-methyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)ethyl pyridine-3-carboxylate (PubChem CID 12671261) has the molecular formula C16H16N6O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-(7-methyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)ethyl pyridine-3-carboxylate.
| Compound Name | 2-(7-methyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)ethyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 12671261 |
| Molecular Formula | C16H16N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 2-(7-methyl-1,3,8,10,12-pentazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-yl)ethyl pyridine-3-carboxylate |
| SMILES | Cc1nc2ncnn2c2c1CCN2CCOC(=O)c1cccnc1 |
| InChI | InChI=1S/C16H16N6O2/c1-11-13-4-6-21(14(13)22-16(20-11)18-10-19-22)7-8-24-15(23)12-3-2-5-17-9-12/h2-3,5,9-10H,4,6-8H2,1H3 |
| InChIKey | XIAIYUKGIRBFMI-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 85.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |