C14H18O — CID 126712648
4-methyl-1,2,3,4,5,6,7,8-octahydrofluoren-9-one (PubChem CID 126712648) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 4-methyl-1,2,3,4,5,6,7,8-octahydrofluoren-9-one.
| Compound Name | 4-methyl-1,2,3,4,5,6,7,8-octahydrofluoren-9-one |
|---|---|
| PubChem CID | 126712648 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 4-methyl-1,2,3,4,5,6,7,8-octahydrofluoren-9-one |
| SMILES | CC1CCCC2=C1C1=C(CCCC1)C2=O |
| InChI | InChI=1S/C14H18O/c1-9-5-4-8-12-13(9)10-6-2-3-7-11(10)14(12)15/h9H,2-8H2,1H3 |
| InChIKey | VYWWRPVLLUEIIC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |