C10H22N4 — CID 126712699
1-N'-methyl-1-N'-[1-(3-methyl-1,2,3,6-tetrahydropyridazin-4-yl)ethyl]ethane-1,1-diamine (PubChem CID 126712699) has the molecular formula C10H22N4 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-N'-methyl-1-N'-[1-(3-methyl-1,2,3,6-tetrahydropyridazin-4-yl)ethyl]ethane-1,1-diamine.
| Compound Name | 1-N'-methyl-1-N'-[1-(3-methyl-1,2,3,6-tetrahydropyridazin-4-yl)ethyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 126712699 |
| Molecular Formula | C10H22N4 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | 1-N'-methyl-1-N'-[1-(3-methyl-1,2,3,6-tetrahydropyridazin-4-yl)ethyl]ethane-1,1-diamine |
| SMILES | CC1NNCC=C1C(C)N(C)C(C)N |
| InChI | InChI=1S/C10H22N4/c1-7-10(5-6-12-13-7)8(2)14(4)9(3)11/h5,7-9,12-13H,6,11H2,1-4H3 |
| InChIKey | VNTLLCYPABWULP-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|