C8H8N4S — CID 12671277
7-methyl-3-thia-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene (PubChem CID 12671277) has the molecular formula C8H8N4S and a molecular weight of 192.25 g/mol. Its IUPAC name is 7-methyl-3-thia-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene.
| Compound Name | 7-methyl-3-thia-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
|---|---|
| PubChem CID | 12671277 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 7-methyl-3-thia-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
| SMILES | Cc1nc2ncnn2c2c1CCS2 |
| InChI | InChI=1S/C8H8N4S/c1-5-6-2-3-13-7(6)12-8(11-5)9-4-10-12/h4H,2-3H2,1H3 |
| InChIKey | YVYIBRIAQZYPCA-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |