C9H10Cl2N4 — CID 12671298
7-chloro-6-(2-chloropropyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 12671298) has the molecular formula C9H10Cl2N4 and a molecular weight of 245.11 g/mol. Its IUPAC name is 7-chloro-6-(2-chloropropyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-chloro-6-(2-chloropropyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 12671298 |
| Molecular Formula | C9H10Cl2N4 |
| Molecular Weight | 245.11 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 7-chloro-6-(2-chloropropyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1nc2ncnn2c(Cl)c1CC(C)Cl |
| InChI | InChI=1S/C9H10Cl2N4/c1-5(10)3-7-6(2)14-9-12-4-13-15(9)8(7)11/h4-5H,3H2,1-2H3 |
| InChIKey | FTKDTAIJEHEFQJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.11 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|