C10H12Cl2N4 — CID 12671299
7-chloro-6-(2-chlorobutyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 12671299) has the molecular formula C10H12Cl2N4 and a molecular weight of 259.14 g/mol. Its IUPAC name is 7-chloro-6-(2-chlorobutyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-chloro-6-(2-chlorobutyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 12671299 |
| Molecular Formula | C10H12Cl2N4 |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 7-chloro-6-(2-chlorobutyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | CCC(Cl)Cc1c(C)nc2ncnn2c1Cl |
| InChI | InChI=1S/C10H12Cl2N4/c1-3-7(11)4-8-6(2)15-10-13-5-14-16(10)9(8)12/h5,7H,3-4H2,1-2H3 |
| InChIKey | BRXXJYIQKKKYHC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|