C15H29NO — CID 126713281
(2E,4E,6R)-8-(dimethylamino)-5,6-diethyl-7-methylocta-2,4-dien-3-ol (PubChem CID 126713281) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is (2E,4E,6R)-8-(dimethylamino)-5,6-diethyl-7-methylocta-2,4-dien-3-ol.
| Compound Name | (2E,4E,6R)-8-(dimethylamino)-5,6-diethyl-7-methylocta-2,4-dien-3-ol |
|---|---|
| PubChem CID | 126713281 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | (2E,4E,6R)-8-(dimethylamino)-5,6-diethyl-7-methylocta-2,4-dien-3-ol |
| SMILES | C/C=C(O)\C=C(/CC)[C@H](CC)C(C)CN(C)C |
| InChI | InChI=1S/C15H29NO/c1-7-13(10-14(17)8-2)15(9-3)12(4)11-16(5)6/h8,10,12,15,17H,7,9,11H2,1-6H3/b13-10+,14-8+/t12?,15-/m1/s1 |
| InChIKey | KRDWQUJDFUOWRV-HZJICYOISA-N |
| XLogP | 4.01 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|