C6H3F5S — CID 126713549
2,3,4,5,6-pentafluorocyclohexa-2,4-diene-1-thiol (PubChem CID 126713549) has the molecular formula C6H3F5S and a molecular weight of 202.15 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluorocyclohexa-2,4-diene-1-thiol.
| Compound Name | 2,3,4,5,6-pentafluorocyclohexa-2,4-diene-1-thiol |
|---|---|
| PubChem CID | 126713549 |
| Molecular Formula | C6H3F5S |
| Molecular Weight | 202.15 g/mol |
| Exact Mass | 201.99 |
| IUPAC Name | 2,3,4,5,6-pentafluorocyclohexa-2,4-diene-1-thiol |
| SMILES | FC1=C(F)C(F)C(S)C(F)=C1F |
| InChI | InChI=1S/C6H3F5S/c7-1-2(8)4(10)6(12)5(11)3(1)9/h4,6,12H |
| InChIKey | RBPLZIXLUSFKRR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.15 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|