C16H29N — CID 126713798
(3Z,5E)-N,2,5-trimethyl-2-(3-methylbut-2-en-2-yl)octa-3,5-dien-1-amine (PubChem CID 126713798) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is (3Z,5E)-N,2,5-trimethyl-2-(3-methylbut-2-en-2-yl)octa-3,5-dien-1-amine.
| Compound Name | (3Z,5E)-N,2,5-trimethyl-2-(3-methylbut-2-en-2-yl)octa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 126713798 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | (3Z,5E)-N,2,5-trimethyl-2-(3-methylbut-2-en-2-yl)octa-3,5-dien-1-amine |
| SMILES | CC/C=C(C)/C=C\C(C)(CNC)C(C)=C(C)C |
| InChI | InChI=1S/C16H29N/c1-8-9-14(4)10-11-16(6,12-17-7)15(5)13(2)3/h9-11,17H,8,12H2,1-7H3/b11-10-,14-9+ |
| InChIKey | MIEQEQDFFYEXBZ-YYUCOLILSA-N |
| XLogP | 4.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|