About 3,3-diphenylfuro[3,4-c]pyridin-1-one
3,3-diphenylfuro[3,4-c]pyridin-1-one (PubChem CID 12671386) has the molecular formula C19H13NO2
and a molecular weight of 287.32 g/mol. Its IUPAC name is 3,3-diphenylfuro[3,4-c]pyridin-1-one.
Molecular Properties
| Compound Name | 3,3-diphenylfuro[3,4-c]pyridin-1-one |
| PubChem CID | 12671386 |
| Molecular Formula | C19H13NO2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3,3-diphenylfuro[3,4-c]pyridin-1-one |
| SMILES | O=C1OC(c2ccccc2)(c2ccccc2)c2cnccc21 |
| InChI | InChI=1S/C19H13NO2/c21-18-16-11-12-20-13-17(16)19(22-18,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13H |
| InChIKey | WRIYFJLSKGSDNZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3-diphenylfuro[3,4-c]pyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diphenylfuro[3,4-c]pyridin-1-one?
The IUPAC name of 3,3-diphenylfuro[3,4-c]pyridin-1-one (CID 12671386) is 3,3-diphenylfuro[3,4-c]pyridin-1-one.
What is the SMILES notation for 3,3-diphenylfuro[3,4-c]pyridin-1-one?
The canonical SMILES for 3,3-diphenylfuro[3,4-c]pyridin-1-one is O=C1OC(c2ccccc2)(c2ccccc2)c2cnccc21.
What is the InChIKey of 3,3-diphenylfuro[3,4-c]pyridin-1-one?
The InChIKey is WRIYFJLSKGSDNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NO2/c21-18-16-11-12-20-13-17(16)19(22-18,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13H.
What are the key properties of 3,3-diphenylfuro[3,4-c]pyridin-1-one?
3,3-diphenylfuro[3,4-c]pyridin-1-one has a molecular weight of 287.32 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diphenylfuro[3,4-c]pyridin-1-one is sourced from PubChem (CID 12671386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).