C11H12N4 — CID 126714040
5-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]amino]-1H-pyrazole-4-carbonitrile (PubChem CID 126714040) has the molecular formula C11H12N4 and a molecular weight of 200.24 g/mol. Its IUPAC name is 5-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]amino]-1H-pyrazole-4-carbonitrile.
| Compound Name | 5-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]amino]-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 126714040 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 5-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]amino]-1H-pyrazole-4-carbonitrile |
| SMILES | C=C/C(=C\C=C/C)Nc1[nH]ncc1C#N |
| InChI | InChI=1S/C11H12N4/c1-3-5-6-10(4-2)14-11-9(7-12)8-13-15-11/h3-6,8H,2H2,1H3,(H2,13,14,15)/b5-3-,10-6+ |
| InChIKey | QHOVVKPPQBTKPT-UTMABKKZSA-N |
| XLogP | 2.34 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|