C26H39NO4 — CID 126714173
[ethyl-(3-phenyl-2-bicyclo[2.2.1]heptanyl)carbamoyl]oxymethyl 2,2,4,4-tetramethylpentanoate (PubChem CID 126714173) has the molecular formula C26H39NO4 and a molecular weight of 429.60 g/mol. Its IUPAC name is [ethyl-(3-phenyl-2-bicyclo[2.2.1]heptanyl)carbamoyl]oxymethyl 2,2,4,4-tetramethylpentanoate.
| Compound Name | [ethyl-(3-phenyl-2-bicyclo[2.2.1]heptanyl)carbamoyl]oxymethyl 2,2,4,4-tetramethylpentanoate |
|---|---|
| PubChem CID | 126714173 |
| Molecular Formula | C26H39NO4 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | [ethyl-(3-phenyl-2-bicyclo[2.2.1]heptanyl)carbamoyl]oxymethyl 2,2,4,4-tetramethylpentanoate |
| SMILES | CCN(C(=O)OCOC(=O)C(C)(C)CC(C)(C)C)C1C2CCC(C2)C1c1ccccc1 |
| InChI | InChI=1S/C26H39NO4/c1-7-27(24(29)31-17-30-23(28)26(5,6)16-25(2,3)4)22-20-14-13-19(15-20)21(22)18-11-9-8-10-12-18/h8-12,19-22H,7,13-17H2,1-6H3 |
| InChIKey | LUJMIYYMWINZNQ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|