C25H38N2S2 — CID 126714266
2-[1-[6-[[(4Z,6Z)-3-methylidene-8-sulfanylnona-1,4,6-trien-2-yl]amino]hexylamino]ethenyl]cyclohepta-1,4-diene-1-thiol (PubChem CID 126714266) has the molecular formula C25H38N2S2 and a molecular weight of 430.73 g/mol. Its IUPAC name is 2-[1-[6-[[(4Z,6Z)-3-methylidene-8-sulfanylnona-1,4,6-trien-2-yl]amino]hexylamino]ethenyl]cyclohepta-1,4-diene-1-thiol.
| Compound Name | 2-[1-[6-[[(4Z,6Z)-3-methylidene-8-sulfanylnona-1,4,6-trien-2-yl]amino]hexylamino]ethenyl]cyclohepta-1,4-diene-1-thiol |
|---|---|
| PubChem CID | 126714266 |
| Molecular Formula | C25H38N2S2 |
| Molecular Weight | 430.73 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 2-[1-[6-[[(4Z,6Z)-3-methylidene-8-sulfanylnona-1,4,6-trien-2-yl]amino]hexylamino]ethenyl]cyclohepta-1,4-diene-1-thiol |
| SMILES | C=C(/C=C\C=C/C(C)S)C(=C)NCCCCCCNC(=C)C1=C(S)CCC=CC1 |
| InChI | InChI=1S/C25H38N2S2/c1-20(14-10-11-15-21(2)28)22(3)26-18-12-5-6-13-19-27-23(4)24-16-8-7-9-17-25(24)29/h7-8,10-11,14-15,21,26-29H,1,3-6,9,12-13,16-19H2,2H3/b14-10-,15-11- |
| InChIKey | UTLNRCJHLSKEOR-HYQBVQLESA-N |
| XLogP | 6.66 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.73 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|