About N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine
N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine (PubChem CID 126714321) has the molecular formula C11H20N4
and a molecular weight of 208.31 g/mol. Its IUPAC name is N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine.
Molecular Properties
| Compound Name | N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine |
| PubChem CID | 126714321 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine |
| SMILES | C=CCn1ccnc1CNCCCCN |
| InChI | InChI=1S/C11H20N4/c1-2-8-15-9-7-14-11(15)10-13-6-4-3-5-12/h2,7,9,13H,1,3-6,8,10,12H2 |
| InChIKey | AUEUWRAPZAXCKC-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine?
The IUPAC name of N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine (CID 126714321) is N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine.
What is the SMILES notation for N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine?
The canonical SMILES for N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine is C=CCn1ccnc1CNCCCCN.
What is the InChIKey of N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine?
The InChIKey is AUEUWRAPZAXCKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4/c1-2-8-15-9-7-14-11(15)10-13-6-4-3-5-12/h2,7,9,13H,1,3-6,8,10,12H2.
What are the key properties of N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine?
N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine has a molecular weight of 208.31 g/mol, XLogP of 0.90, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(1-prop-2-enylimidazol-2-yl)methyl]butane-1,4-diamine is sourced from PubChem (CID 126714321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).