About 2-chloro-5-(3,4-dichlorophenyl)pyrazine
2-chloro-5-(3,4-dichlorophenyl)pyrazine (PubChem CID 12671441) has the molecular formula C10H5Cl3N2
and a molecular weight of 259.52 g/mol. Its IUPAC name is 2-chloro-5-(3,4-dichlorophenyl)pyrazine.
Molecular Properties
| Compound Name | 2-chloro-5-(3,4-dichlorophenyl)pyrazine |
| PubChem CID | 12671441 |
| Molecular Formula | C10H5Cl3N2 |
| Molecular Weight | 259.52 g/mol |
| Exact Mass | 257.95 |
| IUPAC Name | 2-chloro-5-(3,4-dichlorophenyl)pyrazine |
| SMILES | Clc1cnc(-c2ccc(Cl)c(Cl)c2)cn1 |
| InChI | InChI=1S/C10H5Cl3N2/c11-7-2-1-6(3-8(7)12)9-4-15-10(13)5-14-9/h1-5H |
| InChIKey | KTMUYKOOYSKMON-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-5-(3,4-dichlorophenyl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(3,4-dichlorophenyl)pyrazine?
The IUPAC name of 2-chloro-5-(3,4-dichlorophenyl)pyrazine (CID 12671441) is 2-chloro-5-(3,4-dichlorophenyl)pyrazine.
What is the SMILES notation for 2-chloro-5-(3,4-dichlorophenyl)pyrazine?
The canonical SMILES for 2-chloro-5-(3,4-dichlorophenyl)pyrazine is Clc1cnc(-c2ccc(Cl)c(Cl)c2)cn1.
What is the InChIKey of 2-chloro-5-(3,4-dichlorophenyl)pyrazine?
The InChIKey is KTMUYKOOYSKMON-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Cl3N2/c11-7-2-1-6(3-8(7)12)9-4-15-10(13)5-14-9/h1-5H.
What are the key properties of 2-chloro-5-(3,4-dichlorophenyl)pyrazine?
2-chloro-5-(3,4-dichlorophenyl)pyrazine has a molecular weight of 259.52 g/mol, XLogP of 4.10, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(3,4-dichlorophenyl)pyrazine is sourced from PubChem (CID 12671441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).