About 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-dimethoxypyridine
2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-dimethoxypyridine (PubChem CID 126714553) has the molecular formula C19H17F2N3O3
and a molecular weight of 373.36 g/mol. Its IUPAC name is 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-dimethoxypyridine.
Molecular Properties
| Compound Name | 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-dimethoxypyridine |
| PubChem CID | 126714553 |
| Molecular Formula | C19H17F2N3O3 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-dimethoxypyridine |
| SMILES | COc1ccc(OC)c(-c2cccnc2Oc2ccc(C(C)(F)F)nc2)n1 |
| InChI | InChI=1S/C19H17F2N3O3/c1-19(20,21)15-8-6-12(11-23-15)27-18-13(5-4-10-22-18)17-14(25-2)7-9-16(24-17)26-3/h4-11H,1-3H3 |
| InChIKey | JNNSVQVOBNVNHL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-dimethoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-dimethoxypyridine?
The IUPAC name of 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-dimethoxypyridine (CID 126714553) is 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-dimethoxypyridine.
What is the SMILES notation for 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-dimethoxypyridine?
The canonical SMILES for 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-dimethoxypyridine is COc1ccc(OC)c(-c2cccnc2Oc2ccc(C(C)(F)F)nc2)n1.
What is the InChIKey of 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-dimethoxypyridine?
The InChIKey is JNNSVQVOBNVNHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F2N3O3/c1-19(20,21)15-8-6-12(11-23-15)27-18-13(5-4-10-22-18)17-14(25-2)7-9-16(24-17)26-3/h4-11H,1-3H3.
What are the key properties of 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-dimethoxypyridine?
2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-dimethoxypyridine has a molecular weight of 373.36 g/mol, XLogP of 4.46, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[6-(1,1-difluoroethyl)-3-pyridinyl]oxy]-3-pyridinyl]-3,6-dimethoxypyridine is sourced from PubChem (CID 126714553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).