C42H42F2O5 — CID 126714865
1-[(1S,3S,5S,6R)-2,2-difluoro-5,6-bis(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexyl]oxy-2-[(4-methoxyphenyl)methyl]benzene (PubChem CID 126714865) has the molecular formula C42H42F2O5 and a molecular weight of 664.79 g/mol. Its IUPAC name is 1-[(1S,3S,5S,6R)-2,2-difluoro-5,6-bis(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexyl]oxy-2-[(4-methoxyphenyl)methyl]benzene.
| Compound Name | 1-[(1S,3S,5S,6R)-2,2-difluoro-5,6-bis(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexyl]oxy-2-[(4-methoxyphenyl)methyl]benzene |
|---|---|
| PubChem CID | 126714865 |
| Molecular Formula | C42H42F2O5 |
| Molecular Weight | 664.79 g/mol |
| Exact Mass | 664.30 |
| IUPAC Name | 1-[(1S,3S,5S,6R)-2,2-difluoro-5,6-bis(phenylmethoxy)-3-(phenylmethoxymethyl)cyclohexyl]oxy-2-[(4-methoxyphenyl)methyl]benzene |
| SMILES | COc1ccc(Cc2ccccc2O[C@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)C[C@@H](COCc3ccccc3)C2(F)F)cc1 |
| InChI | InChI=1S/C42H42F2O5/c1-45-37-23-21-31(22-24-37)25-35-19-11-12-20-38(35)49-41-40(48-29-34-17-9-4-10-18-34)39(47-28-33-15-7-3-8-16-33)26-36(42(41,43)44)30-46-27-32-13-5-2-6-14-32/h2-24,36,39-41H,25-30H2,1H3/t36-,39-,40+,41-/m0/s1 |
| InChIKey | KBUMVNDJJZRXPG-GXBKDEQOSA-N |
| XLogP | 9.08 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.79 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |