About 5-bromo-N-[(1R,2S)-2-methyl-1-(1-methylpyrazol-4-yl)cyclopropyl]-1H-indole-2-carboxamide
5-bromo-N-[(1R,2S)-2-methyl-1-(1-methylpyrazol-4-yl)cyclopropyl]-1H-indole-2-carboxamide (PubChem CID 126714928) has the molecular formula C17H17BrN4O
and a molecular weight of 373.25 g/mol. Its IUPAC name is 5-bromo-N-[(1R,2S)-2-methyl-1-(1-methylpyrazol-4-yl)cyclopropyl]-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-[(1R,2S)-2-methyl-1-(1-methylpyrazol-4-yl)cyclopropyl]-1H-indole-2-carboxamide |
| PubChem CID | 126714928 |
| Molecular Formula | C17H17BrN4O |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 5-bromo-N-[(1R,2S)-2-methyl-1-(1-methylpyrazol-4-yl)cyclopropyl]-1H-indole-2-carboxamide |
| SMILES | C[C@H]1C[C@]1(NC(=O)c1cc2cc(Br)ccc2[nH]1)c1cnn(C)c1 |
| InChI | InChI=1S/C17H17BrN4O/c1-10-7-17(10,12-8-19-22(2)9-12)21-16(23)15-6-11-5-13(18)3-4-14(11)20-15/h3-6,8-10,20H,7H2,1-2H3,(H,21,23)/t10-,17+/m0/s1 |
| InChIKey | DWNWOEPUWVBYQD-DYZYQPBXSA-N |
| XLogP | 3.33 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-bromo-N-[(1R,2S)-2-methyl-1-(1-methylpyrazol-4-yl)cyclopropyl]-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[(1R,2S)-2-methyl-1-(1-methylpyrazol-4-yl)cyclopropyl]-1H-indole-2-carboxamide?
The IUPAC name of 5-bromo-N-[(1R,2S)-2-methyl-1-(1-methylpyrazol-4-yl)cyclopropyl]-1H-indole-2-carboxamide (CID 126714928) is 5-bromo-N-[(1R,2S)-2-methyl-1-(1-methylpyrazol-4-yl)cyclopropyl]-1H-indole-2-carboxamide.
What is the SMILES notation for 5-bromo-N-[(1R,2S)-2-methyl-1-(1-methylpyrazol-4-yl)cyclopropyl]-1H-indole-2-carboxamide?
The canonical SMILES for 5-bromo-N-[(1R,2S)-2-methyl-1-(1-methylpyrazol-4-yl)cyclopropyl]-1H-indole-2-carboxamide is C[C@H]1C[C@]1(NC(=O)c1cc2cc(Br)ccc2[nH]1)c1cnn(C)c1.
What is the InChIKey of 5-bromo-N-[(1R,2S)-2-methyl-1-(1-methylpyrazol-4-yl)cyclopropyl]-1H-indole-2-carboxamide?
The InChIKey is DWNWOEPUWVBYQD-DYZYQPBXSA-N. The full InChI is InChI=1S/C17H17BrN4O/c1-10-7-17(10,12-8-19-22(2)9-12)21-16(23)15-6-11-5-13(18)3-4-14(11)20-15/h3-6,8-10,20H,7H2,1-2H3,(H,21,23)/t10-,17+/m0/s1.
What are the key properties of 5-bromo-N-[(1R,2S)-2-methyl-1-(1-methylpyrazol-4-yl)cyclopropyl]-1H-indole-2-carboxamide?
5-bromo-N-[(1R,2S)-2-methyl-1-(1-methylpyrazol-4-yl)cyclopropyl]-1H-indole-2-carboxamide has a molecular weight of 373.25 g/mol, XLogP of 3.33, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[(1R,2S)-2-methyl-1-(1-methylpyrazol-4-yl)cyclopropyl]-1H-indole-2-carboxamide is sourced from PubChem (CID 126714928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).