C29H33F2N4O10P — CID 126715324
propan-2-yl 2-[[[(2R,3R,5R)-5-[4-(1,3-benzodioxol-5-ylmethylamino)-2-oxopyrimidin-1-yl]-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 126715324) has the molecular formula C29H33F2N4O10P and a molecular weight of 666.57 g/mol. Its IUPAC name is propan-2-yl 2-[[[(2R,3R,5R)-5-[4-(1,3-benzodioxol-5-ylmethylamino)-2-oxopyrimidin-1-yl]-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | propan-2-yl 2-[[[(2R,3R,5R)-5-[4-(1,3-benzodioxol-5-ylmethylamino)-2-oxopyrimidin-1-yl]-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 126715324 |
| Molecular Formula | C29H33F2N4O10P |
| Molecular Weight | 666.57 g/mol |
| Exact Mass | 666.19 |
| IUPAC Name | propan-2-yl 2-[[[(2R,3R,5R)-5-[4-(1,3-benzodioxol-5-ylmethylamino)-2-oxopyrimidin-1-yl]-4,4-difluoro-3-hydroxyoxolan-2-yl]methoxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CC(C)OC(=O)C(C)NP(=O)(OC[C@H]1O[C@@H](n2ccc(NCc3ccc4c(c3)OCO4)nc2=O)C(F)(F)[C@@H]1O)Oc1ccccc1 |
| InChI | InChI=1S/C29H33F2N4O10P/c1-17(2)43-26(37)18(3)34-46(39,45-20-7-5-4-6-8-20)42-15-23-25(36)29(30,31)27(44-23)35-12-11-24(33-28(35)38)32-14-19-9-10-21-22(13-19)41-16-40-21/h4-13,17-18,23,25,27,36H,14-16H2,1-3H3,(H,34,39)(H,32,33,38)/t18?,23-,25-,27-,46?/m1/s1 |
| InChIKey | ZCYCNVGNTWSWFQ-YURCYOFOSA-N |
| XLogP | 3.61 |
| TPSA | 168.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|