C6H12F2N2O4S — CID 126716157
(3S,4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidine-1-sulfonamide (PubChem CID 126716157) has the molecular formula C6H12F2N2O4S and a molecular weight of 246.23 g/mol. Its IUPAC name is (3S,4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidine-1-sulfonamide.
| Compound Name | (3S,4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 126716157 |
| Molecular Formula | C6H12F2N2O4S |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | (3S,4R,5R)-3-(difluoromethyl)-4,5-dihydroxypiperidine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1C[C@@H](O)[C@H](O)[C@@H](C(F)F)C1 |
| InChI | InChI=1S/C6H12F2N2O4S/c7-6(8)3-1-10(15(9,13)14)2-4(11)5(3)12/h3-6,11-12H,1-2H2,(H2,9,13,14)/t3-,4+,5+/m0/s1 |
| InChIKey | ABFCDUULKJPGSW-VPENINKCSA-N |
| XLogP | -1.89 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |