About 3-methyl-3-(1-methyl-4-propan-2-ylcyclohepta-2,4,6-trien-1-yl)azepine
3-methyl-3-(1-methyl-4-propan-2-ylcyclohepta-2,4,6-trien-1-yl)azepine (PubChem CID 126716301) has the molecular formula C18H23N
and a molecular weight of 253.39 g/mol. Its IUPAC name is 3-methyl-3-(1-methyl-4-propan-2-ylcyclohepta-2,4,6-trien-1-yl)azepine.
Molecular Properties
| Compound Name | 3-methyl-3-(1-methyl-4-propan-2-ylcyclohepta-2,4,6-trien-1-yl)azepine |
| PubChem CID | 126716301 |
| Molecular Formula | C18H23N |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 3-methyl-3-(1-methyl-4-propan-2-ylcyclohepta-2,4,6-trien-1-yl)azepine |
| SMILES | CC(C)C1=CC=CC(C)(C2(C)C=CC=CN=C2)C=C1 |
| InChI | InChI=1S/C18H23N/c1-15(2)16-8-7-11-17(3,12-9-16)18(4)10-5-6-13-19-14-18/h5-15H,1-4H3 |
| InChIKey | KJDIEGHYVAHSCA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-3-(1-methyl-4-propan-2-ylcyclohepta-2,4,6-trien-1-yl)azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-3-(1-methyl-4-propan-2-ylcyclohepta-2,4,6-trien-1-yl)azepine?
The IUPAC name of 3-methyl-3-(1-methyl-4-propan-2-ylcyclohepta-2,4,6-trien-1-yl)azepine (CID 126716301) is 3-methyl-3-(1-methyl-4-propan-2-ylcyclohepta-2,4,6-trien-1-yl)azepine.
What is the SMILES notation for 3-methyl-3-(1-methyl-4-propan-2-ylcyclohepta-2,4,6-trien-1-yl)azepine?
The canonical SMILES for 3-methyl-3-(1-methyl-4-propan-2-ylcyclohepta-2,4,6-trien-1-yl)azepine is CC(C)C1=CC=CC(C)(C2(C)C=CC=CN=C2)C=C1.
What is the InChIKey of 3-methyl-3-(1-methyl-4-propan-2-ylcyclohepta-2,4,6-trien-1-yl)azepine?
The InChIKey is KJDIEGHYVAHSCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N/c1-15(2)16-8-7-11-17(3,12-9-16)18(4)10-5-6-13-19-14-18/h5-15H,1-4H3.
What are the key properties of 3-methyl-3-(1-methyl-4-propan-2-ylcyclohepta-2,4,6-trien-1-yl)azepine?
3-methyl-3-(1-methyl-4-propan-2-ylcyclohepta-2,4,6-trien-1-yl)azepine has a molecular weight of 253.39 g/mol, XLogP of 4.86, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-3-(1-methyl-4-propan-2-ylcyclohepta-2,4,6-trien-1-yl)azepine is sourced from PubChem (CID 126716301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).