About (5R)-N-(2,2-dimethylhexyl)-5-(hydroxymethyl)-4-methyl-5-(trifluoromethyl)nonanamide
(5R)-N-(2,2-dimethylhexyl)-5-(hydroxymethyl)-4-methyl-5-(trifluoromethyl)nonanamide (PubChem CID 126716893) has the molecular formula C20H38F3NO2
and a molecular weight of 381.52 g/mol. Its IUPAC name is (5R)-N-(2,2-dimethylhexyl)-5-(hydroxymethyl)-4-methyl-5-(trifluoromethyl)nonanamide.
Molecular Properties
| Compound Name | (5R)-N-(2,2-dimethylhexyl)-5-(hydroxymethyl)-4-methyl-5-(trifluoromethyl)nonanamide |
| PubChem CID | 126716893 |
| Molecular Formula | C20H38F3NO2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.29 |
| IUPAC Name | (5R)-N-(2,2-dimethylhexyl)-5-(hydroxymethyl)-4-methyl-5-(trifluoromethyl)nonanamide |
| SMILES | CCCCC(C)(C)CNC(=O)CCC(C)[C@@](CO)(CCCC)C(F)(F)F |
| InChI | InChI=1S/C20H38F3NO2/c1-6-8-12-18(4,5)14-24-17(26)11-10-16(3)19(15-25,13-9-7-2)20(21,22)23/h16,25H,6-15H2,1-5H3,(H,24,26)/t16?,19-/m0/s1 |
| InChIKey | RGWVLVRYDHVCBC-CVMIBEPCSA-N |
| XLogP | 5.47 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-N-(2,2-dimethylhexyl)-5-(hydroxymethyl)-4-methyl-5-(trifluoromethyl)nonanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-N-(2,2-dimethylhexyl)-5-(hydroxymethyl)-4-methyl-5-(trifluoromethyl)nonanamide?
The IUPAC name of (5R)-N-(2,2-dimethylhexyl)-5-(hydroxymethyl)-4-methyl-5-(trifluoromethyl)nonanamide (CID 126716893) is (5R)-N-(2,2-dimethylhexyl)-5-(hydroxymethyl)-4-methyl-5-(trifluoromethyl)nonanamide.
What is the SMILES notation for (5R)-N-(2,2-dimethylhexyl)-5-(hydroxymethyl)-4-methyl-5-(trifluoromethyl)nonanamide?
The canonical SMILES for (5R)-N-(2,2-dimethylhexyl)-5-(hydroxymethyl)-4-methyl-5-(trifluoromethyl)nonanamide is CCCCC(C)(C)CNC(=O)CCC(C)[C@@](CO)(CCCC)C(F)(F)F.
What is the InChIKey of (5R)-N-(2,2-dimethylhexyl)-5-(hydroxymethyl)-4-methyl-5-(trifluoromethyl)nonanamide?
The InChIKey is RGWVLVRYDHVCBC-CVMIBEPCSA-N. The full InChI is InChI=1S/C20H38F3NO2/c1-6-8-12-18(4,5)14-24-17(26)11-10-16(3)19(15-25,13-9-7-2)20(21,22)23/h16,25H,6-15H2,1-5H3,(H,24,26)/t16?,19-/m0/s1.
What are the key properties of (5R)-N-(2,2-dimethylhexyl)-5-(hydroxymethyl)-4-methyl-5-(trifluoromethyl)nonanamide?
(5R)-N-(2,2-dimethylhexyl)-5-(hydroxymethyl)-4-methyl-5-(trifluoromethyl)nonanamide has a molecular weight of 381.52 g/mol, XLogP of 5.47, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-N-(2,2-dimethylhexyl)-5-(hydroxymethyl)-4-methyl-5-(trifluoromethyl)nonanamide is sourced from PubChem (CID 126716893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).