About 4-aminopentyl formate
4-aminopentyl formate (PubChem CID 126717031) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is 4-aminopentyl formate.
Molecular Properties
| Compound Name | 4-aminopentyl formate |
| PubChem CID | 126717031 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 4-aminopentyl formate |
| SMILES | CC(N)CCCOC=O |
| InChI | InChI=1S/C6H13NO2/c1-6(7)3-2-4-9-5-8/h5-6H,2-4,7H2,1H3 |
| InChIKey | SQPRCLPGDANKIU-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-aminopentyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminopentyl formate?
The IUPAC name of 4-aminopentyl formate (CID 126717031) is 4-aminopentyl formate.
What is the SMILES notation for 4-aminopentyl formate?
The canonical SMILES for 4-aminopentyl formate is CC(N)CCCOC=O.
What is the InChIKey of 4-aminopentyl formate?
The InChIKey is SQPRCLPGDANKIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c1-6(7)3-2-4-9-5-8/h5-6H,2-4,7H2,1H3.
What are the key properties of 4-aminopentyl formate?
4-aminopentyl formate has a molecular weight of 131.18 g/mol, XLogP of 0.29, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminopentyl formate is sourced from PubChem (CID 126717031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).