C30H39NO — CID 126717052
N-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]-N-[[4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]phenyl]methyl]cyclohexanecarboxamide (PubChem CID 126717052) has the molecular formula C30H39NO and a molecular weight of 429.65 g/mol. Its IUPAC name is N-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]-N-[[4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]phenyl]methyl]cyclohexanecarboxamide.
| Compound Name | N-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]-N-[[4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]phenyl]methyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 126717052 |
| Molecular Formula | C30H39NO |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | N-[(3E,5Z)-2-methylhepta-1,3,5-trien-4-yl]-N-[[4-[(3E)-6-methylhepta-1,3,5-trien-3-yl]phenyl]methyl]cyclohexanecarboxamide |
| SMILES | C=C/C(=C\C=C(C)C)c1ccc(CN(C(=O)C2CCCCC2)C(/C=C\C)=C\C(=C)C)cc1 |
| InChI | InChI=1S/C30H39NO/c1-7-12-29(21-24(5)6)31(30(32)28-13-10-9-11-14-28)22-25-16-19-27(20-17-25)26(8-2)18-15-23(3)4/h7-8,12,15-21,28H,2,5,9-11,13-14,22H2,1,3-4,6H3/b12-7-,26-18+,29-21+ |
| InChIKey | KGUNGAIPYXLVDT-ANAIRBOWSA-N |
| XLogP | 8.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|