C19H13F2N3O3 — CID 126717558
(2S)-6-(4-amino-2,5-difluorophenyl)-2-methyl-4,11-dioxa-1,13-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5,7,9(16),10(14),12-pentaen-15-one (PubChem CID 126717558) has the molecular formula C19H13F2N3O3 and a molecular weight of 369.33 g/mol. Its IUPAC name is (2S)-6-(4-amino-2,5-difluorophenyl)-2-methyl-4,11-dioxa-1,13-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5,7,9(16),10(14),12-pentaen-15-one.
| Compound Name | (2S)-6-(4-amino-2,5-difluorophenyl)-2-methyl-4,11-dioxa-1,13-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5,7,9(16),10(14),12-pentaen-15-one |
|---|---|
| PubChem CID | 126717558 |
| Molecular Formula | C19H13F2N3O3 |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | (2S)-6-(4-amino-2,5-difluorophenyl)-2-methyl-4,11-dioxa-1,13-diazatetracyclo[7.6.1.05,16.010,14]hexadeca-5,7,9(16),10(14),12-pentaen-15-one |
| SMILES | C[C@H]1COc2c(-c3cc(F)c(N)cc3F)ccc3c4ocnc4c(=O)n1c23 |
| InChI | InChI=1S/C19H13F2N3O3/c1-8-6-26-18-9(11-4-13(21)14(22)5-12(11)20)2-3-10-16(18)24(8)19(25)15-17(10)27-7-23-15/h2-5,7-8H,6,22H2,1H3/t8-/m0/s1 |
| InChIKey | DVXGSHBZGLIROV-QMMMGPOBSA-N |
| XLogP | 3.62 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|