C11H20N2O7 — CID 126717650
4-[2-(2-aminoethoxy)ethoxy]-7-hydroxy-6-(hydroxymethyl)-3,3a,4,6,7,7a-hexahydropyrano[3,4-d][1,3]oxazol-2-one (PubChem CID 126717650) has the molecular formula C11H20N2O7 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-[2-(2-aminoethoxy)ethoxy]-7-hydroxy-6-(hydroxymethyl)-3,3a,4,6,7,7a-hexahydropyrano[3,4-d][1,3]oxazol-2-one.
| Compound Name | 4-[2-(2-aminoethoxy)ethoxy]-7-hydroxy-6-(hydroxymethyl)-3,3a,4,6,7,7a-hexahydropyrano[3,4-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 126717650 |
| Molecular Formula | C11H20N2O7 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 4-[2-(2-aminoethoxy)ethoxy]-7-hydroxy-6-(hydroxymethyl)-3,3a,4,6,7,7a-hexahydropyrano[3,4-d][1,3]oxazol-2-one |
| SMILES | NCCOCCOC1OC(CO)C(O)C2OC(=O)NC12 |
| InChI | InChI=1S/C11H20N2O7/c12-1-2-17-3-4-18-10-7-9(20-11(16)13-7)8(15)6(5-14)19-10/h6-10,14-15H,1-5,12H2,(H,13,16) |
| InChIKey | QTXSFTWEAHQNSO-UHFFFAOYSA-N |
| XLogP | -2.47 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|