C15H10F3NO4S — CID 126719529
5-amino-4-(2-carboxyphenyl)sulfanyl-2-(trifluoromethyl)benzoic acid (PubChem CID 126719529) has the molecular formula C15H10F3NO4S and a molecular weight of 357.31 g/mol. Its IUPAC name is 5-amino-4-(2-carboxyphenyl)sulfanyl-2-(trifluoromethyl)benzoic acid.
| Compound Name | 5-amino-4-(2-carboxyphenyl)sulfanyl-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 126719529 |
| Molecular Formula | C15H10F3NO4S |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | 5-amino-4-(2-carboxyphenyl)sulfanyl-2-(trifluoromethyl)benzoic acid |
| SMILES | Nc1cc(C(=O)O)c(C(F)(F)F)cc1Sc1ccccc1C(=O)O |
| InChI | InChI=1S/C15H10F3NO4S/c16-15(17,18)9-6-12(10(19)5-8(9)14(22)23)24-11-4-2-1-3-7(11)13(20)21/h1-6H,19H2,(H,20,21)(H,22,23) |
| InChIKey | KVZLFWFKEBNBDP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|