About 4-bromo-5,5-dimethylfuran-2-one
4-bromo-5,5-dimethylfuran-2-one (PubChem CID 12671960) has the molecular formula C6H7BrO2
and a molecular weight of 191.02 g/mol. Its IUPAC name is 4-bromo-5,5-dimethylfuran-2-one.
Molecular Properties
| Compound Name | 4-bromo-5,5-dimethylfuran-2-one |
| PubChem CID | 12671960 |
| Molecular Formula | C6H7BrO2 |
| Molecular Weight | 191.02 g/mol |
| Exact Mass | 189.96 |
| IUPAC Name | 4-bromo-5,5-dimethylfuran-2-one |
| SMILES | CC1(C)OC(=O)C=C1Br |
| InChI | InChI=1S/C6H7BrO2/c1-6(2)4(7)3-5(8)9-6/h3H,1-2H3 |
| InChIKey | QRYVOYSLXSEKBL-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.02 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-5,5-dimethylfuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5,5-dimethylfuran-2-one?
The IUPAC name of 4-bromo-5,5-dimethylfuran-2-one (CID 12671960) is 4-bromo-5,5-dimethylfuran-2-one.
What is the SMILES notation for 4-bromo-5,5-dimethylfuran-2-one?
The canonical SMILES for 4-bromo-5,5-dimethylfuran-2-one is CC1(C)OC(=O)C=C1Br.
What is the InChIKey of 4-bromo-5,5-dimethylfuran-2-one?
The InChIKey is QRYVOYSLXSEKBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrO2/c1-6(2)4(7)3-5(8)9-6/h3H,1-2H3.
What are the key properties of 4-bromo-5,5-dimethylfuran-2-one?
4-bromo-5,5-dimethylfuran-2-one has a molecular weight of 191.02 g/mol, XLogP of 1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5,5-dimethylfuran-2-one is sourced from PubChem (CID 12671960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).