C14H25N3 — CID 126720216
(3E)-3-N-but-3-enyl-2-N-methyl-3-N-prop-1-en-2-ylhexa-3,5-diene-2,3,5-triamine (PubChem CID 126720216) has the molecular formula C14H25N3 and a molecular weight of 235.37 g/mol. Its IUPAC name is (3E)-3-N-but-3-enyl-2-N-methyl-3-N-prop-1-en-2-ylhexa-3,5-diene-2,3,5-triamine.
| Compound Name | (3E)-3-N-but-3-enyl-2-N-methyl-3-N-prop-1-en-2-ylhexa-3,5-diene-2,3,5-triamine |
|---|---|
| PubChem CID | 126720216 |
| Molecular Formula | C14H25N3 |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.20 |
| IUPAC Name | (3E)-3-N-but-3-enyl-2-N-methyl-3-N-prop-1-en-2-ylhexa-3,5-diene-2,3,5-triamine |
| SMILES | C=CCCN(C(=C)C)/C(=C/C(=C)N)C(C)NC |
| InChI | InChI=1S/C14H25N3/c1-7-8-9-17(11(2)3)14(10-12(4)15)13(5)16-6/h7,10,13,16H,1-2,4,8-9,15H2,3,5-6H3/b14-10+ |
| InChIKey | AUFDJKWJQFAOKF-GXDHUFHOSA-N |
| XLogP | 2.36 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|