About 3-azido-5-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]phenyl]benzoic acid
3-azido-5-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]phenyl]benzoic acid (PubChem CID 126720250) has the molecular formula C20H17F3N4O3
and a molecular weight of 418.38 g/mol. Its IUPAC name is 3-azido-5-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]phenyl]benzoic acid.
Molecular Properties
| Compound Name | 3-azido-5-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]phenyl]benzoic acid |
| PubChem CID | 126720250 |
| Molecular Formula | C20H17F3N4O3 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 3-azido-5-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]phenyl]benzoic acid |
| SMILES | [N-]=[N+]=Nc1cc(C(=O)O)cc(-c2ccc(C3CCN(C(=O)C(F)(F)F)CC3)cc2)c1 |
| InChI | InChI=1S/C20H17F3N4O3/c21-20(22,23)19(30)27-7-5-14(6-8-27)12-1-3-13(4-2-12)15-9-16(18(28)29)11-17(10-15)25-26-24/h1-4,9-11,14H,5-8H2,(H,28,29) |
| InChIKey | TTWPMPGIKBEPLO-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 106.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 3-azido-5-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]phenyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azido-5-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]phenyl]benzoic acid?
The IUPAC name of 3-azido-5-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]phenyl]benzoic acid (CID 126720250) is 3-azido-5-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]phenyl]benzoic acid.
What is the SMILES notation for 3-azido-5-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]phenyl]benzoic acid?
The canonical SMILES for 3-azido-5-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]phenyl]benzoic acid is [N-]=[N+]=Nc1cc(C(=O)O)cc(-c2ccc(C3CCN(C(=O)C(F)(F)F)CC3)cc2)c1.
What is the InChIKey of 3-azido-5-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]phenyl]benzoic acid?
The InChIKey is TTWPMPGIKBEPLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F3N4O3/c21-20(22,23)19(30)27-7-5-14(6-8-27)12-1-3-13(4-2-12)15-9-16(18(28)29)11-17(10-15)25-26-24/h1-4,9-11,14H,5-8H2,(H,28,29).
What are the key properties of 3-azido-5-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]phenyl]benzoic acid?
3-azido-5-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]phenyl]benzoic acid has a molecular weight of 418.38 g/mol, XLogP of 5.26, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azido-5-[4-[1-(2,2,2-trifluoroacetyl)piperidin-4-yl]phenyl]benzoic acid is sourced from PubChem (CID 126720250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).