About 2-ethyl-1-(3-fluorophenyl)sulfonyl-4-piperazin-1-ylimidazo[4,5-c]pyridine
2-ethyl-1-(3-fluorophenyl)sulfonyl-4-piperazin-1-ylimidazo[4,5-c]pyridine (PubChem CID 126720397) has the molecular formula C18H20FN5O2S
and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-ethyl-1-(3-fluorophenyl)sulfonyl-4-piperazin-1-ylimidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 2-ethyl-1-(3-fluorophenyl)sulfonyl-4-piperazin-1-ylimidazo[4,5-c]pyridine |
| PubChem CID | 126720397 |
| Molecular Formula | C18H20FN5O2S |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 2-ethyl-1-(3-fluorophenyl)sulfonyl-4-piperazin-1-ylimidazo[4,5-c]pyridine |
| SMILES | CCc1nc2c(N3CCNCC3)nccc2n1S(=O)(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C18H20FN5O2S/c1-2-16-22-17-15(6-7-21-18(17)23-10-8-20-9-11-23)24(16)27(25,26)14-5-3-4-13(19)12-14/h3-7,12,20H,2,8-11H2,1H3 |
| InChIKey | UXDZDQRAGSHUBW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-ethyl-1-(3-fluorophenyl)sulfonyl-4-piperazin-1-ylimidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-(3-fluorophenyl)sulfonyl-4-piperazin-1-ylimidazo[4,5-c]pyridine?
The IUPAC name of 2-ethyl-1-(3-fluorophenyl)sulfonyl-4-piperazin-1-ylimidazo[4,5-c]pyridine (CID 126720397) is 2-ethyl-1-(3-fluorophenyl)sulfonyl-4-piperazin-1-ylimidazo[4,5-c]pyridine.
What is the SMILES notation for 2-ethyl-1-(3-fluorophenyl)sulfonyl-4-piperazin-1-ylimidazo[4,5-c]pyridine?
The canonical SMILES for 2-ethyl-1-(3-fluorophenyl)sulfonyl-4-piperazin-1-ylimidazo[4,5-c]pyridine is CCc1nc2c(N3CCNCC3)nccc2n1S(=O)(=O)c1cccc(F)c1.
What is the InChIKey of 2-ethyl-1-(3-fluorophenyl)sulfonyl-4-piperazin-1-ylimidazo[4,5-c]pyridine?
The InChIKey is UXDZDQRAGSHUBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FN5O2S/c1-2-16-22-17-15(6-7-21-18(17)23-10-8-20-9-11-23)24(16)27(25,26)14-5-3-4-13(19)12-14/h3-7,12,20H,2,8-11H2,1H3.
What are the key properties of 2-ethyl-1-(3-fluorophenyl)sulfonyl-4-piperazin-1-ylimidazo[4,5-c]pyridine?
2-ethyl-1-(3-fluorophenyl)sulfonyl-4-piperazin-1-ylimidazo[4,5-c]pyridine has a molecular weight of 389.46 g/mol, XLogP of 1.78, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-(3-fluorophenyl)sulfonyl-4-piperazin-1-ylimidazo[4,5-c]pyridine is sourced from PubChem (CID 126720397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).