About N-[5-cyano-2-(hydroxymethyl)-3-pyridinyl]-2,2-dimethylpropanamide
N-[5-cyano-2-(hydroxymethyl)-3-pyridinyl]-2,2-dimethylpropanamide (PubChem CID 126720489) has the molecular formula C12H15N3O2
and a molecular weight of 233.27 g/mol. Its IUPAC name is N-[5-cyano-2-(hydroxymethyl)-3-pyridinyl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-[5-cyano-2-(hydroxymethyl)-3-pyridinyl]-2,2-dimethylpropanamide |
| PubChem CID | 126720489 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-[5-cyano-2-(hydroxymethyl)-3-pyridinyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1cc(C#N)cnc1CO |
| InChI | InChI=1S/C12H15N3O2/c1-12(2,3)11(17)15-9-4-8(5-13)6-14-10(9)7-16/h4,6,16H,7H2,1-3H3,(H,15,17) |
| InChIKey | AERBKKBOKOEBSJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[5-cyano-2-(hydroxymethyl)-3-pyridinyl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-cyano-2-(hydroxymethyl)-3-pyridinyl]-2,2-dimethylpropanamide?
The IUPAC name of N-[5-cyano-2-(hydroxymethyl)-3-pyridinyl]-2,2-dimethylpropanamide (CID 126720489) is N-[5-cyano-2-(hydroxymethyl)-3-pyridinyl]-2,2-dimethylpropanamide.
What is the SMILES notation for N-[5-cyano-2-(hydroxymethyl)-3-pyridinyl]-2,2-dimethylpropanamide?
The canonical SMILES for N-[5-cyano-2-(hydroxymethyl)-3-pyridinyl]-2,2-dimethylpropanamide is CC(C)(C)C(=O)Nc1cc(C#N)cnc1CO.
What is the InChIKey of N-[5-cyano-2-(hydroxymethyl)-3-pyridinyl]-2,2-dimethylpropanamide?
The InChIKey is AERBKKBOKOEBSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O2/c1-12(2,3)11(17)15-9-4-8(5-13)6-14-10(9)7-16/h4,6,16H,7H2,1-3H3,(H,15,17).
What are the key properties of N-[5-cyano-2-(hydroxymethyl)-3-pyridinyl]-2,2-dimethylpropanamide?
N-[5-cyano-2-(hydroxymethyl)-3-pyridinyl]-2,2-dimethylpropanamide has a molecular weight of 233.27 g/mol, XLogP of 1.43, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-cyano-2-(hydroxymethyl)-3-pyridinyl]-2,2-dimethylpropanamide is sourced from PubChem (CID 126720489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).