C26H26F5N5O6S — CID 126720500
[3-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)-2-pyridinyl]methyl 2-(2,3-difluoro-4-sulfamoylbenzoyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 126720500) has the molecular formula C26H26F5N5O6S and a molecular weight of 631.58 g/mol. Its IUPAC name is [3-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)-2-pyridinyl]methyl 2-(2,3-difluoro-4-sulfamoylbenzoyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | [3-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)-2-pyridinyl]methyl 2-(2,3-difluoro-4-sulfamoylbenzoyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 126720500 |
| Molecular Formula | C26H26F5N5O6S |
| Molecular Weight | 631.58 g/mol |
| Exact Mass | 631.15 |
| IUPAC Name | [3-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)-2-pyridinyl]methyl 2-(2,3-difluoro-4-sulfamoylbenzoyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)C(=O)Nc1cc(C(F)(F)F)cnc1COC(=O)N1CC2=C(C1)CN(C(=O)c1ccc(S(N)(=O)=O)c(F)c1F)C2 |
| InChI | InChI=1S/C26H26F5N5O6S/c1-25(2,3)23(38)34-17-6-15(26(29,30)31)7-33-18(17)12-42-24(39)36-10-13-8-35(9-14(13)11-36)22(37)16-4-5-19(43(32,40)41)21(28)20(16)27/h4-7H,8-12H2,1-3H3,(H,34,38)(H2,32,40,41) |
| InChIKey | UZTXHXYLFOLAIC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 152.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|