C25H27F4N5O7S2 — CID 126720505
[3-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)-2-pyridinyl]methyl 5-(2-fluoro-4-sulfamoylphenyl)sulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate (PubChem CID 126720505) has the molecular formula C25H27F4N5O7S2 and a molecular weight of 649.65 g/mol. Its IUPAC name is [3-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)-2-pyridinyl]methyl 5-(2-fluoro-4-sulfamoylphenyl)sulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate.
| Compound Name | [3-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)-2-pyridinyl]methyl 5-(2-fluoro-4-sulfamoylphenyl)sulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 126720505 |
| Molecular Formula | C25H27F4N5O7S2 |
| Molecular Weight | 649.65 g/mol |
| Exact Mass | 649.13 |
| IUPAC Name | [3-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)-2-pyridinyl]methyl 5-(2-fluoro-4-sulfamoylphenyl)sulfonyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)C(=O)Nc1cc(C(F)(F)F)cnc1COC(=O)N1CC2=C(C1)CN(S(=O)(=O)c1ccc(S(N)(=O)=O)cc1F)C2 |
| InChI | InChI=1S/C25H27F4N5O7S2/c1-24(2,3)22(35)32-19-6-16(25(27,28)29)8-31-20(19)13-41-23(36)33-9-14-11-34(12-15(14)10-33)43(39,40)21-5-4-17(7-18(21)26)42(30,37)38/h4-8H,9-13H2,1-3H3,(H,32,35)(H2,30,37,38) |
| InChIKey | DYNFMEUREYYYSN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 169.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.65 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|