C19H24ClF3N4O3 — CID 126720520
[3-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)-2-pyridinyl]methyl 2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate;hydrochloride (PubChem CID 126720520) has the molecular formula C19H24ClF3N4O3 and a molecular weight of 448.87 g/mol. Its IUPAC name is [3-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)-2-pyridinyl]methyl 2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate;hydrochloride.
| Compound Name | [3-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)-2-pyridinyl]methyl 2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 126720520 |
| Molecular Formula | C19H24ClF3N4O3 |
| Molecular Weight | 448.87 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | [3-(2,2-dimethylpropanoylamino)-5-(trifluoromethyl)-2-pyridinyl]methyl 2,3,4,6-tetrahydro-1H-pyrrolo[3,4-c]pyrrole-5-carboxylate;hydrochloride |
| SMILES | CC(C)(C)C(=O)Nc1cc(C(F)(F)F)cnc1COC(=O)N1CC2=C(CNC2)C1.Cl |
| InChI | InChI=1S/C19H23F3N4O3.ClH/c1-18(2,3)16(27)25-14-4-13(19(20,21)22)7-24-15(14)10-29-17(28)26-8-11-5-23-6-12(11)9-26;/h4,7,23H,5-6,8-10H2,1-3H3,(H,25,27);1H |
| InChIKey | FBDLXNJPUHMEDK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.87 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|