About methylcarbamoyl 6-oxo-5-(2-phenylethyl)-1H-pyridine-3-carboxylate
methylcarbamoyl 6-oxo-5-(2-phenylethyl)-1H-pyridine-3-carboxylate (PubChem CID 126721254) has the molecular formula C16H16N2O4
and a molecular weight of 300.31 g/mol. Its IUPAC name is methylcarbamoyl 6-oxo-5-(2-phenylethyl)-1H-pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methylcarbamoyl 6-oxo-5-(2-phenylethyl)-1H-pyridine-3-carboxylate |
| PubChem CID | 126721254 |
| Molecular Formula | C16H16N2O4 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | methylcarbamoyl 6-oxo-5-(2-phenylethyl)-1H-pyridine-3-carboxylate |
| SMILES | CNC(=O)OC(=O)c1c[nH]c(=O)c(CCc2ccccc2)c1 |
| InChI | InChI=1S/C16H16N2O4/c1-17-16(21)22-15(20)13-9-12(14(19)18-10-13)8-7-11-5-3-2-4-6-11/h2-6,9-10H,7-8H2,1H3,(H,17,21)(H,18,19) |
| InChIKey | HQNAIIIGRIJEBX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methylcarbamoyl 6-oxo-5-(2-phenylethyl)-1H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylcarbamoyl 6-oxo-5-(2-phenylethyl)-1H-pyridine-3-carboxylate?
The IUPAC name of methylcarbamoyl 6-oxo-5-(2-phenylethyl)-1H-pyridine-3-carboxylate (CID 126721254) is methylcarbamoyl 6-oxo-5-(2-phenylethyl)-1H-pyridine-3-carboxylate.
What is the SMILES notation for methylcarbamoyl 6-oxo-5-(2-phenylethyl)-1H-pyridine-3-carboxylate?
The canonical SMILES for methylcarbamoyl 6-oxo-5-(2-phenylethyl)-1H-pyridine-3-carboxylate is CNC(=O)OC(=O)c1c[nH]c(=O)c(CCc2ccccc2)c1.
What is the InChIKey of methylcarbamoyl 6-oxo-5-(2-phenylethyl)-1H-pyridine-3-carboxylate?
The InChIKey is HQNAIIIGRIJEBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O4/c1-17-16(21)22-15(20)13-9-12(14(19)18-10-13)8-7-11-5-3-2-4-6-11/h2-6,9-10H,7-8H2,1H3,(H,17,21)(H,18,19).
What are the key properties of methylcarbamoyl 6-oxo-5-(2-phenylethyl)-1H-pyridine-3-carboxylate?
methylcarbamoyl 6-oxo-5-(2-phenylethyl)-1H-pyridine-3-carboxylate has a molecular weight of 300.31 g/mol, XLogP of 1.66, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylcarbamoyl 6-oxo-5-(2-phenylethyl)-1H-pyridine-3-carboxylate is sourced from PubChem (CID 126721254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).