C23H30N4O3 — CID 126721294
1-benzyl-3-N-methyl-2-oxo-5-N-(3-piperidin-1-ylpropyl)pyridine-3,5-dicarboxamide (PubChem CID 126721294) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 1-benzyl-3-N-methyl-2-oxo-5-N-(3-piperidin-1-ylpropyl)pyridine-3,5-dicarboxamide.
| Compound Name | 1-benzyl-3-N-methyl-2-oxo-5-N-(3-piperidin-1-ylpropyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 126721294 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 1-benzyl-3-N-methyl-2-oxo-5-N-(3-piperidin-1-ylpropyl)pyridine-3,5-dicarboxamide |
| SMILES | CNC(=O)c1cc(C(=O)NCCCN2CCCCC2)cn(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C23H30N4O3/c1-24-22(29)20-15-19(17-27(23(20)30)16-18-9-4-2-5-10-18)21(28)25-11-8-14-26-12-6-3-7-13-26/h2,4-5,9-10,15,17H,3,6-8,11-14,16H2,1H3,(H,24,29)(H,25,28) |
| InChIKey | PKEQNDNSOIJMOR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|