C30H30N4O8 — CID 12672138
bis((Z)-but-2-enedioic acid);2-[4-(1H-indol-3-ylmethyl)piperazin-1-yl]quinoline (PubChem CID 12672138) has the molecular formula C30H30N4O8 and a molecular weight of 574.59 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);2-[4-(1H-indol-3-ylmethyl)piperazin-1-yl]quinoline.
| Compound Name | bis((Z)-but-2-enedioic acid);2-[4-(1H-indol-3-ylmethyl)piperazin-1-yl]quinoline |
|---|---|
| PubChem CID | 12672138 |
| Molecular Formula | C30H30N4O8 |
| Molecular Weight | 574.59 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);2-[4-(1H-indol-3-ylmethyl)piperazin-1-yl]quinoline |
| SMILES | O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O.c1ccc2nc(N3CCN(Cc4c[nH]c5ccccc45)CC3)ccc2c1 |
| InChI | InChI=1S/C22H22N4.2C4H4O4/c1-3-7-20-17(5-1)9-10-22(24-20)26-13-11-25(12-14-26)16-18-15-23-21-8-4-2-6-19(18)21;2*5-3(6)1-2-4(7)8/h1-10,15,23H,11-14,16H2;2*1-2H,(H,5,6)(H,7,8)/b;2*2-1- |
| InChIKey | INMCDUCTFZHWNP-SPIKMXEPSA-N |
| XLogP | 3.46 |
| TPSA | 184.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.59 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|