C13H22ClN3O3S — CID 126721416
1-(1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrole-5-carbonyl)piperidine-4-sulfonamide;hydrochloride (PubChem CID 126721416) has the molecular formula C13H22ClN3O3S and a molecular weight of 335.86 g/mol. Its IUPAC name is 1-(1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrole-5-carbonyl)piperidine-4-sulfonamide;hydrochloride.
| Compound Name | 1-(1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrole-5-carbonyl)piperidine-4-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 126721416 |
| Molecular Formula | C13H22ClN3O3S |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-(1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrole-5-carbonyl)piperidine-4-sulfonamide;hydrochloride |
| SMILES | Cl.NS(=O)(=O)C1CCN(C(=O)C2CC3=C(CNC3)C2)CC1 |
| InChI | InChI=1S/C13H21N3O3S.ClH/c14-20(18,19)12-1-3-16(4-2-12)13(17)9-5-10-7-15-8-11(10)6-9;/h9,12,15H,1-8H2,(H2,14,18,19);1H |
| InChIKey | PKLZQVMXYCWGJL-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|