About 2-[5-(trifluoromethyl)-3-pyridinyl]-1,3,4-thiadiazole
2-[5-(trifluoromethyl)-3-pyridinyl]-1,3,4-thiadiazole (PubChem CID 126722070) has the molecular formula C8H4F3N3S
and a molecular weight of 231.20 g/mol. Its IUPAC name is 2-[5-(trifluoromethyl)-3-pyridinyl]-1,3,4-thiadiazole.
Molecular Properties
| Compound Name | 2-[5-(trifluoromethyl)-3-pyridinyl]-1,3,4-thiadiazole |
| PubChem CID | 126722070 |
| Molecular Formula | C8H4F3N3S |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | 2-[5-(trifluoromethyl)-3-pyridinyl]-1,3,4-thiadiazole |
| SMILES | FC(F)(F)c1cncc(-c2nncs2)c1 |
| InChI | InChI=1S/C8H4F3N3S/c9-8(10,11)6-1-5(2-12-3-6)7-14-13-4-15-7/h1-4H |
| InChIKey | RFFXJOYJMRCYCY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(trifluoromethyl)-3-pyridinyl]-1,3,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(trifluoromethyl)-3-pyridinyl]-1,3,4-thiadiazole?
The IUPAC name of 2-[5-(trifluoromethyl)-3-pyridinyl]-1,3,4-thiadiazole (CID 126722070) is 2-[5-(trifluoromethyl)-3-pyridinyl]-1,3,4-thiadiazole.
What is the SMILES notation for 2-[5-(trifluoromethyl)-3-pyridinyl]-1,3,4-thiadiazole?
The canonical SMILES for 2-[5-(trifluoromethyl)-3-pyridinyl]-1,3,4-thiadiazole is FC(F)(F)c1cncc(-c2nncs2)c1.
What is the InChIKey of 2-[5-(trifluoromethyl)-3-pyridinyl]-1,3,4-thiadiazole?
The InChIKey is RFFXJOYJMRCYCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4F3N3S/c9-8(10,11)6-1-5(2-12-3-6)7-14-13-4-15-7/h1-4H.
What are the key properties of 2-[5-(trifluoromethyl)-3-pyridinyl]-1,3,4-thiadiazole?
2-[5-(trifluoromethyl)-3-pyridinyl]-1,3,4-thiadiazole has a molecular weight of 231.20 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(trifluoromethyl)-3-pyridinyl]-1,3,4-thiadiazole is sourced from PubChem (CID 126722070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).