C20H25F3N2O4 — CID 126722127
(E)-3-[4-[cyclohexyl(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoic acid (PubChem CID 126722127) has the molecular formula C20H25F3N2O4 and a molecular weight of 414.42 g/mol. Its IUPAC name is (E)-3-[4-[cyclohexyl(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoic acid.
| Compound Name | (E)-3-[4-[cyclohexyl(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoic acid |
|---|---|
| PubChem CID | 126722127 |
| Molecular Formula | C20H25F3N2O4 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (E)-3-[4-[cyclohexyl(2-methylpropyl)amino]-3-nitrophenyl]-4,4,4-trifluorobut-2-enoic acid |
| SMILES | CC(C)CN(c1ccc(/C(=C\C(=O)O)C(F)(F)F)cc1[N+](=O)[O-])C1CCCCC1 |
| InChI | InChI=1S/C20H25F3N2O4/c1-13(2)12-24(15-6-4-3-5-7-15)17-9-8-14(10-18(17)25(28)29)16(11-19(26)27)20(21,22)23/h8-11,13,15H,3-7,12H2,1-2H3,(H,26,27)/b16-11+ |
| InChIKey | JHQNKVWUJQSWMK-LFIBNONCSA-N |
| XLogP | 5.42 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|