C40H42F4N6O — CID 126722442
1-[(4,4-difluorocyclohexyl)methyl]-6-(6-methoxy-3-pyridinyl)pyrrolo[3,2-b]pyridine;1-[(4,4-difluorocyclohexyl)methyl]-6-(6-methyl-3-pyridinyl)pyrrolo[3,2-b]pyridine (PubChem CID 126722442) has the molecular formula C40H42F4N6O and a molecular weight of 698.81 g/mol. Its IUPAC name is 1-[(4,4-difluorocyclohexyl)methyl]-6-(6-methoxy-3-pyridinyl)pyrrolo[3,2-b]pyridine;1-[(4,4-difluorocyclohexyl)methyl]-6-(6-methyl-3-pyridinyl)pyrrolo[3,2-b]pyridine.
| Compound Name | 1-[(4,4-difluorocyclohexyl)methyl]-6-(6-methoxy-3-pyridinyl)pyrrolo[3,2-b]pyridine;1-[(4,4-difluorocyclohexyl)methyl]-6-(6-methyl-3-pyridinyl)pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 126722442 |
| Molecular Formula | C40H42F4N6O |
| Molecular Weight | 698.81 g/mol |
| Exact Mass | 698.34 |
| IUPAC Name | 1-[(4,4-difluorocyclohexyl)methyl]-6-(6-methoxy-3-pyridinyl)pyrrolo[3,2-b]pyridine;1-[(4,4-difluorocyclohexyl)methyl]-6-(6-methyl-3-pyridinyl)pyrrolo[3,2-b]pyridine |
| SMILES | COc1ccc(-c2cnc3ccn(CC4CCC(F)(F)CC4)c3c2)cn1.Cc1ccc(-c2cnc3ccn(CC4CCC(F)(F)CC4)c3c2)cn1 |
| InChI | InChI=1S/C20H21F2N3O.C20H21F2N3/c1-26-19-3-2-15(11-24-19)16-10-18-17(23-12-16)6-9-25(18)13-14-4-7-20(21,22)8-5-14;1-14-2-3-16(11-23-14)17-10-19-18(24-12-17)6-9-25(19)13-15-4-7-20(21,22)8-5-15/h2-3,6,9-12,14H,4-5,7-8,13H2,1H3;2-3,6,9-12,15H,4-5,7-8,13H2,1H3 |
| InChIKey | UEBGLKBBOGAGSH-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.81 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|