C12H27NSi2 — CID 12672257
1-cyclohexyl-2,2,5,5-tetramethyl-1,2,5-azadisilolidine (PubChem CID 12672257) has the molecular formula C12H27NSi2 and a molecular weight of 241.53 g/mol. Its IUPAC name is 1-cyclohexyl-2,2,5,5-tetramethyl-1,2,5-azadisilolidine.
| Compound Name | 1-cyclohexyl-2,2,5,5-tetramethyl-1,2,5-azadisilolidine |
|---|---|
| PubChem CID | 12672257 |
| Molecular Formula | C12H27NSi2 |
| Molecular Weight | 241.53 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 1-cyclohexyl-2,2,5,5-tetramethyl-1,2,5-azadisilolidine |
| SMILES | C[Si]1(C)CC[Si](C)(C)N1C1CCCCC1 |
| InChI | InChI=1S/C12H27NSi2/c1-14(2)10-11-15(3,4)13(14)12-8-6-5-7-9-12/h12H,5-11H2,1-4H3 |
| InChIKey | GLEQQMWBRSFMLV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|