C46H32N4O2 — CID 126722708
8,10-dimethoxy-2,3,5,7-tetraphenylporphyrin (PubChem CID 126722708) has the molecular formula C46H32N4O2 and a molecular weight of 672.79 g/mol. Its IUPAC name is 8,10-dimethoxy-2,3,5,7-tetraphenylporphyrin.
| Compound Name | 8,10-dimethoxy-2,3,5,7-tetraphenylporphyrin |
|---|---|
| PubChem CID | 126722708 |
| Molecular Formula | C46H32N4O2 |
| Molecular Weight | 672.79 g/mol |
| Exact Mass | 672.25 |
| IUPAC Name | 8,10-dimethoxy-2,3,5,7-tetraphenylporphyrin |
| SMILES | COC1=C(c2ccccc2)/C2=C(\c3ccccc3)C3=N/C(=C\C4=N/C(=C\C5=N/C(=C(/OC)C1=N2)C=C5)C=C4)C(c1ccccc1)=C3c1ccccc1 |
| InChI | InChI=1S/C46H32N4O2/c1-51-45-36-26-25-34(48-36)27-33-23-24-35(47-33)28-37-38(29-15-7-3-8-16-29)39(30-17-9-4-10-18-30)42(49-37)40(31-19-11-5-12-20-31)43-41(32-21-13-6-14-22-32)46(52-2)44(45)50-43/h3-28H,1-2H3/b33-27-,34-27-,35-28-,37-28-,42-40-,43-40-,45-36+,45-44+ |
| InChIKey | FVNRMPOAZXEPRS-HNJIJYJOSA-N |
| XLogP | 9.64 |
| TPSA | 67.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.79 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|