About 1-tert-butylpteridine-2,4-dione
1-tert-butylpteridine-2,4-dione (PubChem CID 126722737) has the molecular formula C10H12N4O2
and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-tert-butylpteridine-2,4-dione.
Molecular Properties
| Compound Name | 1-tert-butylpteridine-2,4-dione |
| PubChem CID | 126722737 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1-tert-butylpteridine-2,4-dione |
| SMILES | CC(C)(C)n1c(=O)[nH]c(=O)c2nccnc21 |
| InChI | InChI=1S/C10H12N4O2/c1-10(2,3)14-7-6(11-4-5-12-7)8(15)13-9(14)16/h4-5H,1-3H3,(H,13,15,16) |
| InChIKey | IKNSGHDNQZHIJA-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-tert-butylpteridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylpteridine-2,4-dione?
The IUPAC name of 1-tert-butylpteridine-2,4-dione (CID 126722737) is 1-tert-butylpteridine-2,4-dione.
What is the SMILES notation for 1-tert-butylpteridine-2,4-dione?
The canonical SMILES for 1-tert-butylpteridine-2,4-dione is CC(C)(C)n1c(=O)[nH]c(=O)c2nccnc21.
What is the InChIKey of 1-tert-butylpteridine-2,4-dione?
The InChIKey is IKNSGHDNQZHIJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O2/c1-10(2,3)14-7-6(11-4-5-12-7)8(15)13-9(14)16/h4-5H,1-3H3,(H,13,15,16).
What are the key properties of 1-tert-butylpteridine-2,4-dione?
1-tert-butylpteridine-2,4-dione has a molecular weight of 220.23 g/mol, XLogP of 0.23, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylpteridine-2,4-dione is sourced from PubChem (CID 126722737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).