C15H19F3 — CID 126723002
1-cyclohexyl-4-ethyl-2-(trifluoromethyl)benzene (PubChem CID 126723002) has the molecular formula C15H19F3 and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-cyclohexyl-4-ethyl-2-(trifluoromethyl)benzene.
| Compound Name | 1-cyclohexyl-4-ethyl-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 126723002 |
| Molecular Formula | C15H19F3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-cyclohexyl-4-ethyl-2-(trifluoromethyl)benzene |
| SMILES | CCc1ccc(C2CCCCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F3/c1-2-11-8-9-13(12-6-4-3-5-7-12)14(10-11)15(16,17)18/h8-10,12H,2-7H2,1H3 |
| InChIKey | ACSDPFVSFYPYPT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |