C9H12O5 — CID 126723102
(1S,5S,7R,8R,9R)-8,9-dihydroxy-2,6-dioxatricyclo[5.3.1.01,5]undecan-3-one (PubChem CID 126723102) has the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. Its IUPAC name is (1S,5S,7R,8R,9R)-8,9-dihydroxy-2,6-dioxatricyclo[5.3.1.01,5]undecan-3-one.
| Compound Name | (1S,5S,7R,8R,9R)-8,9-dihydroxy-2,6-dioxatricyclo[5.3.1.01,5]undecan-3-one |
|---|---|
| PubChem CID | 126723102 |
| Molecular Formula | C9H12O5 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | (1S,5S,7R,8R,9R)-8,9-dihydroxy-2,6-dioxatricyclo[5.3.1.01,5]undecan-3-one |
| SMILES | O=C1C[C@@H]2O[C@@H]3C[C@]2(C[C@@H](O)[C@H]3O)O1 |
| InChI | InChI=1S/C9H12O5/c10-4-2-9-3-5(8(4)12)13-6(9)1-7(11)14-9/h4-6,8,10,12H,1-3H2/t4-,5-,6+,8-,9+/m1/s1 |
| InChIKey | KUXOIQRMTMTUSK-ITALHOGKSA-N |
| XLogP | -1.04 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |