C13H22F2O4S — CID 126723241
(2R)-1,1-difluoro-3-sulfanyloxy-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]propan-2-ol (PubChem CID 126723241) has the molecular formula C13H22F2O4S and a molecular weight of 312.38 g/mol. Its IUPAC name is (2R)-1,1-difluoro-3-sulfanyloxy-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]propan-2-ol.
| Compound Name | (2R)-1,1-difluoro-3-sulfanyloxy-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 126723241 |
| Molecular Formula | C13H22F2O4S |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | (2R)-1,1-difluoro-3-sulfanyloxy-2-[(4R,5S)-2,2,5-trimethyl-5-(2-methylprop-1-enyl)-1,3-dioxolan-4-yl]propan-2-ol |
| SMILES | CC(C)=C[C@]1(C)OC(C)(C)O[C@@H]1[C@](O)(COS)C(F)F |
| InChI | InChI=1S/C13H22F2O4S/c1-8(2)6-12(5)9(18-11(3,4)19-12)13(16,7-17-20)10(14)15/h6,9-10,16,20H,7H2,1-5H3/t9-,12-,13+/m0/s1 |
| InChIKey | YJFZPJPLBNDIBS-TVYUQYBPSA-N |
| XLogP | 2.72 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|